C16H21NO2 — CID 153427784
ethyl 9-isocyano-9-methyl-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate (PubChem CID 153427784) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl 9-isocyano-9-methyl-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate.
| Compound Name | ethyl 9-isocyano-9-methyl-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate |
|---|---|
| PubChem CID | 153427784 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl 9-isocyano-9-methyl-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate |
| SMILES | [C-]#[N+]C1(C)CC=CCC2(C(=O)OCC)CCCC=C12 |
| InChI | InChI=1S/C16H21NO2/c1-4-19-14(18)16-11-6-5-9-13(16)15(2,17-3)10-7-8-12-16/h7-9H,4-6,10-12H2,1-2H3 |
| InChIKey | VWOOXNXDYPFGJP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|