C21H15NO4 — CID 10641234
ethyl 2-isocyano-5,10-dioxo-1,3-dihydrocyclopenta[b]anthracene-2-carboxylate (PubChem CID 10641234) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl 2-isocyano-5,10-dioxo-1,3-dihydrocyclopenta[b]anthracene-2-carboxylate.
| Compound Name | ethyl 2-isocyano-5,10-dioxo-1,3-dihydrocyclopenta[b]anthracene-2-carboxylate |
|---|---|
| PubChem CID | 10641234 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | ethyl 2-isocyano-5,10-dioxo-1,3-dihydrocyclopenta[b]anthracene-2-carboxylate |
| SMILES | [C-]#[N+]C1(C(=O)OCC)Cc2cc3c(cc2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C21H15NO4/c1-3-26-20(25)21(22-2)10-12-8-16-17(9-13(12)11-21)19(24)15-7-5-4-6-14(15)18(16)23/h4-9H,3,10-11H2,1H3 |
| InChIKey | BEAKZKRBLHOGEY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|