C15H19NO8 — CID 58363677
ethyl 15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylate (PubChem CID 58363677) has the molecular formula C15H19NO8 and a molecular weight of 341.32 g/mol. Its IUPAC name is ethyl 15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylate.
| Compound Name | ethyl 15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylate |
|---|---|
| PubChem CID | 58363677 |
| Molecular Formula | C15H19NO8 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | ethyl 15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-14-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1[N+](=O)[O-])OCCOCCOCCO2 |
| InChI | InChI=1S/C15H19NO8/c1-2-22-15(17)11-9-13-14(10-12(11)16(18)19)24-8-6-21-4-3-20-5-7-23-13/h9-10H,2-8H2,1H3 |
| InChIKey | MQZVRPPDGJXOBK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|