C19H17FN2O7 — CID 7887108
[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 7887108) has the molecular formula C19H17FN2O7 and a molecular weight of 404.35 g/mol. Its IUPAC name is [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 7887108 |
| Molecular Formula | C19H17FN2O7 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O7/c1-2-21(13-5-3-12(20)4-6-13)18(23)11-29-19(24)14-9-16-17(28-8-7-27-16)10-15(14)22(25)26/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | CQKLMMZQDJHNAN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|