C19H13FN2O6S — CID 39818171
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 39818171) has the molecular formula C19H13FN2O6S and a molecular weight of 416.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 39818171 |
| Molecular Formula | C19H13FN2O6S |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccc(F)cc2)n1)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C19H13FN2O6S/c20-12-3-1-11(2-4-12)18-21-13(10-29-18)9-28-19(23)14-7-16-17(27-6-5-26-16)8-15(14)22(24)25/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | QIKHXJVTYVDSJP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|