C19H19NO6 — CID 7523511
(4-propan-2-ylphenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 7523511) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is (4-propan-2-ylphenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | (4-propan-2-ylphenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 7523511 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (4-propan-2-ylphenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | CC(C)c1ccc(COC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-12(2)14-5-3-13(4-6-14)11-26-19(21)15-9-17-18(25-8-7-24-17)10-16(15)20(22)23/h3-6,9-10,12H,7-8,11H2,1-2H3 |
| InChIKey | HSQLKHTVOQJCFX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|