C17H11FN2O6 — CID 37148270
(5-cyano-2-fluorophenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 37148270) has the molecular formula C17H11FN2O6 and a molecular weight of 358.28 g/mol. Its IUPAC name is (5-cyano-2-fluorophenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | (5-cyano-2-fluorophenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 37148270 |
| Molecular Formula | C17H11FN2O6 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (5-cyano-2-fluorophenyl)methyl 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | N#Cc1ccc(F)c(COC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)c1 |
| InChI | InChI=1S/C17H11FN2O6/c18-13-2-1-10(8-19)5-11(13)9-26-17(21)12-6-15-16(25-4-3-24-15)7-14(12)20(22)23/h1-2,5-7H,3-4,9H2 |
| InChIKey | KZQUZCZNEIIVTB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|