C26H43NO10 — CID 142832224
ethane;ethyl 2-[(2-ethoxy-2-oxoethyl)-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)amino]acetate (PubChem CID 142832224) has the molecular formula C26H43NO10 and a molecular weight of 529.63 g/mol. Its IUPAC name is ethane;ethyl 2-[(2-ethoxy-2-oxoethyl)-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)amino]acetate.
| Compound Name | ethane;ethyl 2-[(2-ethoxy-2-oxoethyl)-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)amino]acetate |
|---|---|
| PubChem CID | 142832224 |
| Molecular Formula | C26H43NO10 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | ethane;ethyl 2-[(2-ethoxy-2-oxoethyl)-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)amino]acetate |
| SMILES | CC.CCOC(=O)CN(CC(=O)OCC)c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C24H37NO10.C2H6/c1-3-32-23(26)18-25(19-24(27)33-4-2)20-5-6-21-22(17-20)35-16-14-31-12-10-29-8-7-28-9-11-30-13-15-34-21;1-2/h5-6,17H,3-4,7-16,18-19H2,1-2H3;1-2H3 |
| InChIKey | LZRXUFKKGXKENO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|