C23H28O8 — CID 10993729
ethyl 2-(4-hydroxy-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)acetate (PubChem CID 10993729) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is ethyl 2-(4-hydroxy-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)acetate.
| Compound Name | ethyl 2-(4-hydroxy-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)acetate |
|---|---|
| PubChem CID | 10993729 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | ethyl 2-(4-hydroxy-2,6,13,16,19-pentaoxatricyclo[18.4.0.07,12]tetracosa-1(24),7,9,11,20,22-hexaen-4-yl)acetate |
| SMILES | CCOC(=O)CC1(O)COc2ccccc2OCCOCCOc2ccccc2OC1 |
| InChI | InChI=1S/C23H28O8/c1-2-27-22(24)15-23(25)16-30-20-9-5-3-7-18(20)28-13-11-26-12-14-29-19-8-4-6-10-21(19)31-17-23/h3-10,25H,2,11-17H2,1H3 |
| InChIKey | HOVXGHMRMIYPAM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |