C13H20N4O+2 — CID 6947264
2-[7-(cyanomethyl)-1,5-dimethyl-9-oxo-3,7-diazoniabicyclo[3.3.1]nonan-3-yl]acetonitrile (PubChem CID 6947264) has the molecular formula C13H20N4O+2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[7-(cyanomethyl)-1,5-dimethyl-9-oxo-3,7-diazoniabicyclo[3.3.1]nonan-3-yl]acetonitrile.
| Compound Name | 2-[7-(cyanomethyl)-1,5-dimethyl-9-oxo-3,7-diazoniabicyclo[3.3.1]nonan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 6947264 |
| Molecular Formula | C13H20N4O+2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-[7-(cyanomethyl)-1,5-dimethyl-9-oxo-3,7-diazoniabicyclo[3.3.1]nonan-3-yl]acetonitrile |
| SMILES | CC12C[NH+](CC#N)CC(C)(C[NH+](CC#N)C1)C2=O |
| InChI | InChI=1S/C13H18N4O/c1-12-7-16(5-3-14)9-13(2,11(12)18)10-17(8-12)6-4-15/h5-10H2,1-2H3/p+2 |
| InChIKey | ZOYVCEXSZKWFFE-UHFFFAOYSA-P |
| XLogP | -2.59 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|