About 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione
4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione (PubChem CID 89419588) has the molecular formula C8H9FO4
and a molecular weight of 188.15 g/mol. Its IUPAC name is 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione.
Analyze 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The IUPAC name of 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione (CID 89419588) is 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione.
What is the SMILES notation for 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The canonical SMILES for 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione is CC1(F)CC(=O)OC12CCC(=O)O2.
What is the InChIKey of 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
The InChIKey is VGDLLXULBYDNHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO4/c1-7(9)4-6(11)13-8(7)3-2-5(10)12-8/h2-4H2,1H3.
What are the key properties of 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione?
4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione has a molecular weight of 188.15 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4-methyl-1,6-dioxaspiro[4.4]nonane-2,7-dione is sourced from PubChem (CID 89419588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).