C31H23NO4 — CID 102275857
(1R,2S,5R,6S,7R,10S)-15-trityl-12,14-dioxa-15-azapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,8-diene-11,13-dione (PubChem CID 102275857) has the molecular formula C31H23NO4 and a molecular weight of 473.53 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R,10S)-15-trityl-12,14-dioxa-15-azapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,8-diene-11,13-dione.
| Compound Name | (1R,2S,5R,6S,7R,10S)-15-trityl-12,14-dioxa-15-azapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,8-diene-11,13-dione |
|---|---|
| PubChem CID | 102275857 |
| Molecular Formula | C31H23NO4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (1R,2S,5R,6S,7R,10S)-15-trityl-12,14-dioxa-15-azapentacyclo[4.4.3.12,5.17,10.01,6]pentadeca-3,8-diene-11,13-dione |
| SMILES | O=C1OC(=O)[C@]23[C@@H]4C=C[C@@H](O4)[C@]12[C@H]1C=C[C@@H]3N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H23NO4/c33-27-29-23-16-17-24(30(29,28(34)36-27)26-19-18-25(29)35-26)32(23)31(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,23-26H/t23-,24+,25-,26+,29-,30+ |
| InChIKey | KYUFPCALHGFSGQ-PLZLTHRPSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|