C23H21NO2 — CID 87794852
(2R,3S)-3-methyl-1-tritylaziridine-2-carboxylic acid (PubChem CID 87794852) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R,3S)-3-methyl-1-tritylaziridine-2-carboxylic acid.
| Compound Name | (2R,3S)-3-methyl-1-tritylaziridine-2-carboxylic acid |
|---|---|
| PubChem CID | 87794852 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2R,3S)-3-methyl-1-tritylaziridine-2-carboxylic acid |
| SMILES | C[C@H]1[C@H](C(=O)O)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO2/c1-17-21(22(25)26)24(17)23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21H,1H3,(H,25,26)/t17-,21+,24?/m0/s1 |
| InChIKey | HUPXHRVMFVVBCY-FSWLIYMRSA-N |
| XLogP | 4.14 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|