C25H23NO2 — CID 140630872
(2S)-3-methyl-1-trityl-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 140630872) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S)-3-methyl-1-trityl-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | (2S)-3-methyl-1-trityl-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 140630872 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2S)-3-methyl-1-trityl-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | CC1=CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C25H23NO2/c1-19-17-18-26(23(19)24(27)28)25(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-17,23H,18H2,1H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | LQXPUOLZHVAMSU-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|