C25H23NO4 — CID 69364853
(2S)-1-tritylpyrrolidine-2,4-dicarboxylic acid (PubChem CID 69364853) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is (2S)-1-tritylpyrrolidine-2,4-dicarboxylic acid.
| Compound Name | (2S)-1-tritylpyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 69364853 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S)-1-tritylpyrrolidine-2,4-dicarboxylic acid |
| SMILES | O=C(O)C1C[C@@H](C(=O)O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H23NO4/c27-23(28)18-16-22(24(29)30)26(17-18)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18,22H,16-17H2,(H,27,28)(H,29,30)/t18?,22-/m0/s1 |
| InChIKey | ZLVBOQCTPDSLFM-YSYXNDDBSA-N |
| XLogP | 3.84 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|