C28H34N2O2 — CID 131885421
N-ethylethanamine;(2S)-1-tritylpyrrolidine-2-carboxylic acid (PubChem CID 131885421) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-ethylethanamine;(2S)-1-tritylpyrrolidine-2-carboxylic acid.
| Compound Name | N-ethylethanamine;(2S)-1-tritylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 131885421 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-ethylethanamine;(2S)-1-tritylpyrrolidine-2-carboxylic acid |
| SMILES | CCNCC.O=C(O)[C@@H]1CCCN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO2.C4H11N/c26-23(27)22-17-10-18-25(22)24(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;1-3-5-4-2/h1-9,11-16,22H,10,17-18H2,(H,26,27);5H,3-4H2,1-2H3/t22-;/m0./s1 |
| InChIKey | SDFLSCHGGSMMBS-FTBISJDPSA-N |
| XLogP | 5.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|