C24H23NO3 — CID 15927496
(2S,4S)-4-hydroxy-1-tritylpyrrolidine-2-carboxylic acid (PubChem CID 15927496) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-1-tritylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-hydroxy-1-tritylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 15927496 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2S,4S)-4-hydroxy-1-tritylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c26-21-16-22(23(27)28)25(17-21)24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-22,26H,16-17H2,(H,27,28)/t21-,22-/m0/s1 |
| InChIKey | OFLPLXXUYDYSJP-VXKWHMMOSA-N |
| XLogP | 3.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|