C13H18O2 — CID 13275946
(2S)-2-hydroxy-4,4-dimethyl-2-phenylpentan-3-one (PubChem CID 13275946) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-4,4-dimethyl-2-phenylpentan-3-one.
| Compound Name | (2S)-2-hydroxy-4,4-dimethyl-2-phenylpentan-3-one |
|---|---|
| PubChem CID | 13275946 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2S)-2-hydroxy-4,4-dimethyl-2-phenylpentan-3-one |
| SMILES | CC(C)(C)C(=O)[C@@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-12(2,3)11(14)13(4,15)10-8-6-5-7-9-10/h5-9,15H,1-4H3/t13-/m0/s1 |
| InChIKey | ZXPZFRZPVSBCRE-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |