C22H20O2 — CID 102141893
3-hydroxy-1,1,3-triphenylbutan-2-one (PubChem CID 102141893) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-hydroxy-1,1,3-triphenylbutan-2-one.
| Compound Name | 3-hydroxy-1,1,3-triphenylbutan-2-one |
|---|---|
| PubChem CID | 102141893 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-hydroxy-1,1,3-triphenylbutan-2-one |
| SMILES | CC(O)(C(=O)C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O2/c1-22(24,19-15-9-4-10-16-19)21(23)20(17-11-5-2-6-12-17)18-13-7-3-8-14-18/h2-16,20,24H,1H3 |
| InChIKey | MUACCBWAWBMDJG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |