C14H19NO — CID 134877280
[(2S,3S)-1-tert-butyl-3-methylaziridin-2-yl]-phenylmethanone (PubChem CID 134877280) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is [(2S,3S)-1-tert-butyl-3-methylaziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S,3S)-1-tert-butyl-3-methylaziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134877280 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | [(2S,3S)-1-tert-butyl-3-methylaziridin-2-yl]-phenylmethanone |
| SMILES | C[C@H]1[C@@H](C(=O)c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C14H19NO/c1-10-12(15(10)14(2,3)4)13(16)11-8-6-5-7-9-11/h5-10,12H,1-4H3/t10-,12-,15?/m0/s1 |
| InChIKey | JTEIMWUCIYTHGM-NIUIKUMDSA-N |
| XLogP | 2.74 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|