C13H17NO — CID 11148391
[(2S,3R)-3-tert-butylaziridin-2-yl]-phenylmethanone (PubChem CID 11148391) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is [(2S,3R)-3-tert-butylaziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-3-tert-butylaziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11148391 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | [(2S,3R)-3-tert-butylaziridin-2-yl]-phenylmethanone |
| SMILES | CC(C)(C)[C@H]1N[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO/c1-13(2,3)12-10(14-12)11(15)9-7-5-4-6-8-9/h4-8,10,12,14H,1-3H3/t10-,12+/m1/s1 |
| InChIKey | RLWJLOIMEXGJPV-PWSUYJOCSA-N |
| XLogP | 2.26 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|