C15H19NO — CID 46223892
[(2S,3R)-3-[(E)-hex-1-enyl]aziridin-2-yl]-phenylmethanone (PubChem CID 46223892) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is [(2S,3R)-3-[(E)-hex-1-enyl]aziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-3-[(E)-hex-1-enyl]aziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 46223892 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | [(2S,3R)-3-[(E)-hex-1-enyl]aziridin-2-yl]-phenylmethanone |
| SMILES | CCCC/C=C/[C@H]1N[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO/c1-2-3-4-8-11-13-14(16-13)15(17)12-9-6-5-7-10-12/h5-11,13-14,16H,2-4H2,1H3/b11-8+/t13-,14+/m1/s1 |
| InChIKey | CSNAFLDLWUZAKO-GELOPOQCSA-N |
| XLogP | 2.96 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|