C20H24O3 — CID 135068948
(4E)-7-benzoyl-5-[(E)-hex-1-enyl]-2,3,6,7-tetrahydrooxocin-8-one (PubChem CID 135068948) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (4E)-7-benzoyl-5-[(E)-hex-1-enyl]-2,3,6,7-tetrahydrooxocin-8-one.
| Compound Name | (4E)-7-benzoyl-5-[(E)-hex-1-enyl]-2,3,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 135068948 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (4E)-7-benzoyl-5-[(E)-hex-1-enyl]-2,3,6,7-tetrahydrooxocin-8-one |
| SMILES | CCCC/C=C/C1=C/CCOC(=O)C(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H24O3/c1-2-3-4-6-10-16-11-9-14-23-20(22)18(15-16)19(21)17-12-7-5-8-13-17/h5-8,10-13,18H,2-4,9,14-15H2,1H3/b10-6+,16-11- |
| InChIKey | GFIADLOHRNWIHC-FAIWILQLSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|