C20H18O3 — CID 135066563
(4E)-7-benzoyl-5-phenyl-2,3,6,7-tetrahydrooxocin-8-one (PubChem CID 135066563) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (4E)-7-benzoyl-5-phenyl-2,3,6,7-tetrahydrooxocin-8-one.
| Compound Name | (4E)-7-benzoyl-5-phenyl-2,3,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 135066563 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (4E)-7-benzoyl-5-phenyl-2,3,6,7-tetrahydrooxocin-8-one |
| SMILES | O=C1OCC/C=C(/c2ccccc2)CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18O3/c21-19(16-10-5-2-6-11-16)18-14-17(12-7-13-23-20(18)22)15-8-3-1-4-9-15/h1-6,8-12,18H,7,13-14H2/b17-12+ |
| InChIKey | YGSMOHQPNNXXAD-SFQUDFHCSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|