C9H6O4 — CID 139798399
4-benzoyl-1,3-dioxetan-2-one (PubChem CID 139798399) has the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. Its IUPAC name is 4-benzoyl-1,3-dioxetan-2-one.
| Compound Name | 4-benzoyl-1,3-dioxetan-2-one |
|---|---|
| PubChem CID | 139798399 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4-benzoyl-1,3-dioxetan-2-one |
| SMILES | O=C1OC(C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C9H6O4/c10-7(8-12-9(11)13-8)6-4-2-1-3-5-6/h1-5,8H |
| InChIKey | NDUWZDKVCJVHFA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |