C21H22ClNO — CID 98513159
N-[(1R,4Z,7R)-7-chloro-5-phenylcyclooct-4-en-1-yl]benzamide (PubChem CID 98513159) has the molecular formula C21H22ClNO and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[(1R,4Z,7R)-7-chloro-5-phenylcyclooct-4-en-1-yl]benzamide.
| Compound Name | N-[(1R,4Z,7R)-7-chloro-5-phenylcyclooct-4-en-1-yl]benzamide |
|---|---|
| PubChem CID | 98513159 |
| Molecular Formula | C21H22ClNO |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[(1R,4Z,7R)-7-chloro-5-phenylcyclooct-4-en-1-yl]benzamide |
| SMILES | O=C(N[C@@H]1CC/C=C(/c2ccccc2)C[C@@H](Cl)C1)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO/c22-19-14-18(16-8-3-1-4-9-16)12-7-13-20(15-19)23-21(24)17-10-5-2-6-11-17/h1-6,8-12,19-20H,7,13-15H2,(H,23,24)/b18-12+/t19-,20-/m1/s1 |
| InChIKey | OLZQLUTXISDFGC-WJZSJHQNSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|