C14H12O3 — CID 98116545
(3aR,7aS)-5-phenyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 98116545) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is (3aR,7aS)-5-phenyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aR,7aS)-5-phenyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 98116545 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (3aR,7aS)-5-phenyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)[C@@H]2CC(c3ccccc3)=CC[C@H]12 |
| InChI | InChI=1S/C14H12O3/c15-13-11-7-6-10(8-12(11)14(16)17-13)9-4-2-1-3-5-9/h1-6,11-12H,7-8H2/t11-,12+/m0/s1 |
| InChIKey | JKYWPOLMZPJQML-NWDGAFQWSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|