C26H22O3 — CID 101391492
(10E,14E)-11,14-diphenyl-5-oxatricyclo[7.6.0.03,7]pentadeca-1(9),10,14-triene-4,6-dione (PubChem CID 101391492) has the molecular formula C26H22O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (10E,14E)-11,14-diphenyl-5-oxatricyclo[7.6.0.03,7]pentadeca-1(9),10,14-triene-4,6-dione.
| Compound Name | (10E,14E)-11,14-diphenyl-5-oxatricyclo[7.6.0.03,7]pentadeca-1(9),10,14-triene-4,6-dione |
|---|---|
| PubChem CID | 101391492 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (10E,14E)-11,14-diphenyl-5-oxatricyclo[7.6.0.03,7]pentadeca-1(9),10,14-triene-4,6-dione |
| SMILES | O=C1OC(=O)C2CC3=C(/C=C(/c4ccccc4)CC/C(c4ccccc4)=C\3)CC12 |
| InChI | InChI=1S/C26H22O3/c27-25-23-15-21-13-19(17-7-3-1-4-8-17)11-12-20(18-9-5-2-6-10-18)14-22(21)16-24(23)26(28)29-25/h1-10,13-14,23-24H,11-12,15-16H2/b19-13+,20-14+ |
| InChIKey | GCFYTJCUHXQPMU-IWGRKNQJSA-N |
| XLogP | 5.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|