C12H12O2 — CID 22149773
4-phenylcyclohexa-1,3-diene-1,2-diol (PubChem CID 22149773) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-phenylcyclohexa-1,3-diene-1,2-diol.
| Compound Name | 4-phenylcyclohexa-1,3-diene-1,2-diol |
|---|---|
| PubChem CID | 22149773 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-phenylcyclohexa-1,3-diene-1,2-diol |
| SMILES | OC1=C(O)CCC(c2ccccc2)=C1 |
| InChI | InChI=1S/C12H12O2/c13-11-7-6-10(8-12(11)14)9-4-2-1-3-5-9/h1-5,8,13-14H,6-7H2 |
| InChIKey | DFHCVSZWJMZVFA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |