C14H14O — CID 163869651
1-(4-phenylcyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 163869651) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(4-phenylcyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(4-phenylcyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 163869651 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(4-phenylcyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H14O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-7,9H,8,10H2,1H3 |
| InChIKey | PJQXUFJSRWPHDI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |