C18H14O3 — CID 101045101
(3aS,4S,9aR)-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1,3-dione (PubChem CID 101045101) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3aS,4S,9aR)-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1,3-dione.
| Compound Name | (3aS,4S,9aR)-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1,3-dione |
|---|---|
| PubChem CID | 101045101 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (3aS,4S,9aR)-4-phenyl-3a,4,9,9a-tetrahydrobenzo[f][2]benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)[C@@H]2Cc3ccccc3[C@H](c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C18H14O3/c19-17-14-10-12-8-4-5-9-13(12)15(16(14)18(20)21-17)11-6-2-1-3-7-11/h1-9,14-16H,10H2/t14-,15+,16-/m1/s1 |
| InChIKey | CWFSVPVDOXFGOD-OWCLPIDISA-N |
| XLogP | 2.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|