C20H17BrO4 — CID 10834876
methyl (1S,4S,4aS,9aS)-1-bromo-3-oxo-4-phenyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyran-1-carboxylate (PubChem CID 10834876) has the molecular formula C20H17BrO4 and a molecular weight of 401.26 g/mol. Its IUPAC name is methyl (1S,4S,4aS,9aS)-1-bromo-3-oxo-4-phenyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyran-1-carboxylate.
| Compound Name | methyl (1S,4S,4aS,9aS)-1-bromo-3-oxo-4-phenyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyran-1-carboxylate |
|---|---|
| PubChem CID | 10834876 |
| Molecular Formula | C20H17BrO4 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | methyl (1S,4S,4aS,9aS)-1-bromo-3-oxo-4-phenyl-4,4a,9,9a-tetrahydroindeno[2,1-c]pyran-1-carboxylate |
| SMILES | COC(=O)[C@]1(Br)OC(=O)[C@H](c2ccccc2)[C@@H]2c3ccccc3C[C@@H]21 |
| InChI | InChI=1S/C20H17BrO4/c1-24-19(23)20(21)15-11-13-9-5-6-10-14(13)17(15)16(18(22)25-20)12-7-3-2-4-8-12/h2-10,15-17H,11H2,1H3/t15-,16+,17+,20+/m0/s1 |
| InChIKey | WGNJOIZFPPYDJD-TVKQPGBESA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|