C28H33NO2 — CID 101177320
(1R,2S,4R,6R,9S,13R)-6,10,10-trimethyl-21-phenyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15,17,19-trien-12-one (PubChem CID 101177320) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (1R,2S,4R,6R,9S,13R)-6,10,10-trimethyl-21-phenyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15,17,19-trien-12-one.
| Compound Name | (1R,2S,4R,6R,9S,13R)-6,10,10-trimethyl-21-phenyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15,17,19-trien-12-one |
|---|---|
| PubChem CID | 101177320 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (1R,2S,4R,6R,9S,13R)-6,10,10-trimethyl-21-phenyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15,17,19-trien-12-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@@H]3C(c4ccccc4)c4ccccc4C[C@H]3C(=O)N1C2(C)C |
| InChI | InChI=1S/C28H33NO2/c1-17-13-14-22-23(15-17)31-27-25-21(26(30)29(27)28(22,2)3)16-19-11-7-8-12-20(19)24(25)18-9-5-4-6-10-18/h4-12,17,21-25,27H,13-16H2,1-3H3/t17-,21-,22-,23-,24?,25+,27+/m1/s1 |
| InChIKey | NNEXEHCDVCLMRI-RIDJMRGRSA-N |
| XLogP | 5.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |