C21H31NO — CID 101098048
(3S,6R,11S)-11-ethyl-2,2,6-trimethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene (PubChem CID 101098048) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is (3S,6R,11S)-11-ethyl-2,2,6-trimethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene.
| Compound Name | (3S,6R,11S)-11-ethyl-2,2,6-trimethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
|---|---|
| PubChem CID | 101098048 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (3S,6R,11S)-11-ethyl-2,2,6-trimethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
| SMILES | CC[C@H]1c2ccccc2CN2C1OC1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C21H31NO/c1-5-16-17-9-7-6-8-15(17)13-22-20(16)23-19-12-14(2)10-11-18(19)21(22,3)4/h6-9,14,16,18-20H,5,10-13H2,1-4H3/t14-,16+,18-,19?,20?/m1/s1 |
| InChIKey | CFUWDTHGXJSIDX-AGIRHVDMSA-N |
| XLogP | 4.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |