C22H33NO — CID 101098050
(3S,6R,11S)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene (PubChem CID 101098050) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (3S,6R,11S)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene.
| Compound Name | (3S,6R,11S)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
|---|---|
| PubChem CID | 101098050 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (3S,6R,11S)-2,2,6-trimethyl-11-propan-2-yl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
| SMILES | CC(C)[C@H]1c2ccccc2CN2C1OC1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C22H33NO/c1-14(2)20-17-9-7-6-8-16(17)13-23-21(20)24-19-12-15(3)10-11-18(19)22(23,4)5/h6-9,14-15,18-21H,10-13H2,1-5H3/t15-,18-,19?,20+,21?/m1/s1 |
| InChIKey | NMDOLALFPZAAPL-AOKOXZKVSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |