C21H31NO — CID 134997445
(1S,15R)-8,8,11,11,15-pentamethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene (PubChem CID 134997445) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is (1S,15R)-8,8,11,11,15-pentamethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene.
| Compound Name | (1S,15R)-8,8,11,11,15-pentamethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
|---|---|
| PubChem CID | 134997445 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (1S,15R)-8,8,11,11,15-pentamethyl-18-oxa-10-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-triene |
| SMILES | C[C@@H]1CCC2C(C1)O[C@H]1c3ccccc3C(C)(C)CN1C2(C)C |
| InChI | InChI=1S/C21H31NO/c1-14-10-11-17-18(12-14)23-19-15-8-6-7-9-16(15)20(2,3)13-22(19)21(17,4)5/h6-9,14,17-19H,10-13H2,1-5H3/t14-,17?,18?,19+/m1/s1 |
| InChIKey | NZDYUVKKKKPFBV-UJPJLTBQSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |