C20H28BrNO — CID 135077359
(2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 135077359) has the molecular formula C20H28BrNO and a molecular weight of 378.35 g/mol. Its IUPAC name is (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 135077359 |
| Molecular Formula | C20H28BrNO |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2S,7R)-2-(2-bromophenyl)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | C=CCN1[C@H](c2ccccc2Br)OC2C[C@H](C)CCC2C1(C)C |
| InChI | InChI=1S/C20H28BrNO/c1-5-12-22-19(15-8-6-7-9-17(15)21)23-18-13-14(2)10-11-16(18)20(22,3)4/h5-9,14,16,18-19H,1,10-13H2,2-4H3/t14-,16?,18?,19+/m1/s1 |
| InChIKey | PSSNYQQRIXHEKR-LEDLJOFTSA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|