C37H43NO2Se — CID 11570803
(2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-naphthalen-1-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11570803) has the molecular formula C37H43NO2Se and a molecular weight of 612.72 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-naphthalen-1-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-naphthalen-1-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11570803 |
| Molecular Formula | C37H43NO2Se |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-naphthalen-1-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CO[C@@H](c1ccccc1)[C@@H](CN1[C@H](c2cccc3ccccc23)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C37H43NO2Se/c1-26-22-23-32-33(24-26)40-36(31-21-13-17-27-14-11-12-20-30(27)31)38(37(32,2)3)25-34(41-29-18-9-6-10-19-29)35(39-4)28-15-7-5-8-16-28/h5-21,26,32-36H,22-25H2,1-4H3/t26-,32-,33-,34-,35+,36+/m1/s1 |
| InChIKey | JIYFSAPLPRIEHI-NSFYKMPTSA-N |
| XLogP | 7.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|