C33H40N2O4Se — CID 11721395
(2S,4aS,7R,8aR)-3-[(2S,3R)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-(4-nitrophenyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11721395) has the molecular formula C33H40N2O4Se and a molecular weight of 607.65 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-[(2S,3R)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-(4-nitrophenyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-[(2S,3R)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-(4-nitrophenyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11721395 |
| Molecular Formula | C33H40N2O4Se |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-[(2S,3R)-3-methoxy-3-phenyl-2-phenylselanylpropyl]-4,4,7-trimethyl-2-(4-nitrophenyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CO[C@H](c1ccccc1)[C@H](CN1[C@H](c2ccc([N+](=O)[O-])cc2)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C33H40N2O4Se/c1-23-15-20-28-29(21-23)39-32(25-16-18-26(19-17-25)35(36)37)34(33(28,2)3)22-30(40-27-13-9-6-10-14-27)31(38-4)24-11-7-5-8-12-24/h5-14,16-19,23,28-32H,15,20-22H2,1-4H3/t23-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | JTEYVAZEFJDRIP-YZIWXIRQSA-N |
| XLogP | 6.71 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|