C27H35NO4 — CID 155987267
N-[(2R,4R,4aS,7R,8aR)-2-(3,4-dimethoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-phenylacetamide (PubChem CID 155987267) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(3,4-dimethoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-phenylacetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(3,4-dimethoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 155987267 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(3,4-dimethoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-phenylacetamide |
| SMILES | COc1ccc([C@H]2C[C@@](C)(NC(=O)Cc3ccccc3)[C@@H]3CC[C@@H](C)C[C@H]3O2)cc1OC |
| InChI | InChI=1S/C27H35NO4/c1-18-10-12-21-23(14-18)32-25(20-11-13-22(30-3)24(16-20)31-4)17-27(21,2)28-26(29)15-19-8-6-5-7-9-19/h5-9,11,13,16,18,21,23,25H,10,12,14-15,17H2,1-4H3,(H,28,29)/t18-,21-,23-,25-,27-/m1/s1 |
| InChIKey | ZZMUOFKYFWUCEK-WPVUXZDTSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |