C23H34N2O3 — CID 110142465
N-[(2R,4R,4aS,7R,8aR)-2-(4-acetamidophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide (PubChem CID 110142465) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-(4-acetamidophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-(4-acetamidophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110142465 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-(4-acetamidophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
| SMILES | CC(=O)Nc1ccc([C@H]2C[C@@](C)(NC(=O)C(C)C)[C@@H]3CC[C@@H](C)C[C@H]3O2)cc1 |
| InChI | InChI=1S/C23H34N2O3/c1-14(2)22(27)25-23(5)13-21(28-20-12-15(3)6-11-19(20)23)17-7-9-18(10-8-17)24-16(4)26/h7-10,14-15,19-21H,6,11-13H2,1-5H3,(H,24,26)(H,25,27)/t15-,19-,20-,21-,23-/m1/s1 |
| InChIKey | QZOJFDLMRVDTTO-LBZJANNGSA-N |
| XLogP | 4.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |