C26H37N3O2 — CID 110153008
N-[(2R,4R,4aS,7R,8aR)-2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide (PubChem CID 110153008) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110153008 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
| SMILES | Cc1cc(C)n(-c2cccc([C@H]3C[C@@](C)(NC(=O)C(C)C)[C@@H]4CC[C@@H](C)C[C@H]4O3)c2)n1 |
| InChI | InChI=1S/C26H37N3O2/c1-16(2)25(30)27-26(6)15-24(31-23-12-17(3)10-11-22(23)26)20-8-7-9-21(14-20)29-19(5)13-18(4)28-29/h7-9,13-14,16-17,22-24H,10-12,15H2,1-6H3,(H,27,30)/t17-,22-,23-,24-,26-/m1/s1 |
| InChIKey | FLYFEHXUEPPYDW-OTJYMVIVSA-N |
| XLogP | 5.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |