C20H26F3NO2 — CID 110142456
N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide (PubChem CID 110142456) has the molecular formula C20H26F3NO2 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110142456 |
| Molecular Formula | C20H26F3NO2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
| SMILES | CC(=O)N[C@]1(C)C[C@H](c2cccc(C(F)(F)F)c2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C20H26F3NO2/c1-12-7-8-16-17(9-12)26-18(11-19(16,3)24-13(2)25)14-5-4-6-15(10-14)20(21,22)23/h4-6,10,12,16-18H,7-9,11H2,1-3H3,(H,24,25)/t12-,16-,17-,18-,19-/m1/s1 |
| InChIKey | RFWYZZSZNWJGEW-RRARJMIVSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |