C21H30FNO2 — CID 110142517
N-[(2R,4S,4aS,7R,8aR)-2-(3-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide (PubChem CID 110142517) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[(2R,4S,4aS,7R,8aR)-2-(3-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide.
| Compound Name | N-[(2R,4S,4aS,7R,8aR)-2-(3-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110142517 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-[(2R,4S,4aS,7R,8aR)-2-(3-fluorophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@]1(C)C[C@H](c2cccc(F)c2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C21H30FNO2/c1-13(2)20(24)23-21(4)12-19(15-6-5-7-16(22)11-15)25-18-10-14(3)8-9-17(18)21/h5-7,11,13-14,17-19H,8-10,12H2,1-4H3,(H,23,24)/t14-,17-,18-,19-,21+/m1/s1 |
| InChIKey | KOXPSGWQGNEMFD-LUXPHIFBSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |