C22H31NO5 — CID 110158655
3-[(2R,4R,4aS,7R,8aR)-4-(3-methoxypropanoylamino)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]benzoic acid (PubChem CID 110158655) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 3-[(2R,4R,4aS,7R,8aR)-4-(3-methoxypropanoylamino)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]benzoic acid.
| Compound Name | 3-[(2R,4R,4aS,7R,8aR)-4-(3-methoxypropanoylamino)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110158655 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 3-[(2R,4R,4aS,7R,8aR)-4-(3-methoxypropanoylamino)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]benzoic acid |
| SMILES | COCCC(=O)N[C@]1(C)C[C@H](c2cccc(C(=O)O)c2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C22H31NO5/c1-14-7-8-17-18(11-14)28-19(15-5-4-6-16(12-15)21(25)26)13-22(17,2)23-20(24)9-10-27-3/h4-6,12,14,17-19H,7-11,13H2,1-3H3,(H,23,24)(H,25,26)/t14-,17-,18-,19-,22-/m1/s1 |
| InChIKey | MGYJXQSOBDEDQA-DHSNVRAJSA-N |
| XLogP | 3.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |