C23H32BrNO2 — CID 110135283
N-[(2S,4S,4aR,7S,8aS)-2-(3-bromophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]cyclopentanecarboxamide (PubChem CID 110135283) has the molecular formula C23H32BrNO2 and a molecular weight of 434.42 g/mol. Its IUPAC name is N-[(2S,4S,4aR,7S,8aS)-2-(3-bromophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]cyclopentanecarboxamide.
| Compound Name | N-[(2S,4S,4aR,7S,8aS)-2-(3-bromophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110135283 |
| Molecular Formula | C23H32BrNO2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(2S,4S,4aR,7S,8aS)-2-(3-bromophenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]cyclopentanecarboxamide |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)O[C@H](c1cccc(Br)c1)C[C@]2(C)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C23H32BrNO2/c1-15-10-11-19-20(12-15)27-21(17-8-5-9-18(24)13-17)14-23(19,2)25-22(26)16-6-3-4-7-16/h5,8-9,13,15-16,19-21H,3-4,6-7,10-12,14H2,1-2H3,(H,25,26)/t15-,19-,20-,21-,23-/m0/s1 |
| InChIKey | AFHMURQINWUAON-VUUZQCJOSA-N |
| XLogP | 5.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |