C18H22F3NO2 — CID 110134027
N-[(2R,4R,4aS,8aR)-2-[3-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]acetamide (PubChem CID 110134027) has the molecular formula C18H22F3NO2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-[3-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-[3-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110134027 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-[3-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H](c2cccc(C(F)(F)F)c2)O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C18H22F3NO2/c1-11(23)22-15-10-17(24-16-8-3-2-7-14(15)16)12-5-4-6-13(9-12)18(19,20)21/h4-6,9,14-17H,2-3,7-8,10H2,1H3,(H,22,23)/t14-,15+,16+,17+/m0/s1 |
| InChIKey | MCSKLJUKWVEYGJ-YLFCFFPRSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |