C23H35NO2Se — CID 11991752
(3S,6R,8R,10S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11991752) has the molecular formula C23H35NO2Se and a molecular weight of 436.50 g/mol. Its IUPAC name is (3S,6R,8R,10S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11991752 |
| Molecular Formula | C23H35NO2Se |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (3S,6R,8R,10S,13S)-2,2,6-trimethyl-13-(2-phenylselanylpropan-2-yl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1CO[C@H](C(C)(C)[Se]c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C23H35NO2Se/c1-16-11-12-18-19(13-16)26-21-15-25-20(14-24(21)22(18,2)3)23(4,5)27-17-9-7-6-8-10-17/h6-10,16,18-21H,11-15H2,1-5H3/t16-,18-,19-,20+,21+/m1/s1 |
| InChIKey | LEZLKCZCYSRASC-JFHUYLGKSA-N |
| XLogP | 3.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|