C27H35NO2Se — CID 11991747
(3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-11-phenyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11991747) has the molecular formula C27H35NO2Se and a molecular weight of 484.54 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-11-phenyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-11-phenyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11991747 |
| Molecular Formula | C27H35NO2Se |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (3S,6R,8R,10S,11S,13S)-2,2,6-trimethyl-11-phenyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](c3ccccc3)O[C@H](C[Se]c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C27H35NO2Se/c1-19-14-15-23-24(16-19)30-26-25(20-10-6-4-7-11-20)29-21(17-28(26)27(23,2)3)18-31-22-12-8-5-9-13-22/h4-13,19,21,23-26H,14-18H2,1-3H3/t19-,21+,23-,24-,25+,26+/m1/s1 |
| InChIKey | BHVASMYKECMFDT-UTARBRDJSA-N |
| XLogP | 4.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|