C23H33NO2 — CID 11121812
(1R,3S,4R,5S,9S,12R)-8,8,12-trimethyl-4-phenyl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol (PubChem CID 11121812) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (1R,3S,4R,5S,9S,12R)-8,8,12-trimethyl-4-phenyl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol.
| Compound Name | (1R,3S,4R,5S,9S,12R)-8,8,12-trimethyl-4-phenyl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol |
|---|---|
| PubChem CID | 11121812 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (1R,3S,4R,5S,9S,12R)-8,8,12-trimethyl-4-phenyl-5-prop-1-en-2-yl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-4-ol |
| SMILES | C=C(C)[C@H]1CN2[C@@H](O[C@@H]3C[C@H](C)CC[C@H]3C2(C)C)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C23H33NO2/c1-15(2)19-14-24-21(23(19,25)17-9-7-6-8-10-17)26-20-13-16(3)11-12-18(20)22(24,4)5/h6-10,16,18-21,25H,1,11-14H2,2-5H3/t16-,18-,19-,20-,21+,23+/m1/s1 |
| InChIKey | NWVIKISDFSIVKG-YZGHALFISA-N |
| XLogP | 4.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|